C20H19F2NO3 — CID 140994328
benzyl (2R)-4,4-difluoro-1-(2-phenylacetyl)pyrrolidine-2-carboxylate (PubChem CID 140994328) has the molecular formula C20H19F2NO3 and a molecular weight of 359.37 g/mol. Its IUPAC name is benzyl (2R)-4,4-difluoro-1-(2-phenylacetyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2R)-4,4-difluoro-1-(2-phenylacetyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140994328 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | benzyl (2R)-4,4-difluoro-1-(2-phenylacetyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CC(F)(F)CN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H19F2NO3/c21-20(22)12-17(19(25)26-13-16-9-5-2-6-10-16)23(14-20)18(24)11-15-7-3-1-4-8-15/h1-10,17H,11-14H2/t17-/m1/s1 |
| InChIKey | FGAWFUMZIPJXRM-QGZVFWFLSA-N |
| XLogP | 3.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |