C13H15F2N3O3 — CID 86609167
benzyl (2S)-4,4-difluoro-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylate (PubChem CID 86609167) has the molecular formula C13H15F2N3O3 and a molecular weight of 299.28 g/mol. Its IUPAC name is benzyl (2S)-4,4-difluoro-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-4,4-difluoro-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86609167 |
| Molecular Formula | C13H15F2N3O3 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | benzyl (2S)-4,4-difluoro-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylate |
| SMILES | NC(=NO)[C@@H]1CC(F)(F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15F2N3O3/c14-13(15)6-10(11(16)17-20)18(8-13)12(19)21-7-9-4-2-1-3-5-9/h1-5,10,20H,6-8H2,(H2,16,17)/t10-/m0/s1 |
| InChIKey | LROXCXFJLLGPRB-JTQLQIEISA-N |
| XLogP | 1.78 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|