C25H37N6O4P — CID 166877392
propan-2-yl (2S)-2-[[[3-methyl-2-[2-[6-(methylamino)purin-9-yl]ethyl]butoxy]-phenoxyphosphanyl]amino]propanoate (PubChem CID 166877392) has the molecular formula C25H37N6O4P and a molecular weight of 516.58 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[3-methyl-2-[2-[6-(methylamino)purin-9-yl]ethyl]butoxy]-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[3-methyl-2-[2-[6-(methylamino)purin-9-yl]ethyl]butoxy]-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 166877392 |
| Molecular Formula | C25H37N6O4P |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | propan-2-yl (2S)-2-[[[3-methyl-2-[2-[6-(methylamino)purin-9-yl]ethyl]butoxy]-phenoxyphosphanyl]amino]propanoate |
| SMILES | CNc1ncnc2c1ncn2CCC(COP(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)C(C)C |
| InChI | InChI=1S/C25H37N6O4P/c1-17(2)20(12-13-31-16-29-22-23(26-6)27-15-28-24(22)31)14-33-36(35-21-10-8-7-9-11-21)30-19(5)25(32)34-18(3)4/h7-11,15-20,30H,12-14H2,1-6H3,(H,26,27,28)/t19-,20?,36?/m0/s1 |
| InChIKey | LZJFVBZZHBRKGV-TWDGFOQYSA-N |
| XLogP | 4.78 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|