C24H30FN6O6P — CID 177345570
propan-2-yl (2S)-2-[[[(1R,2R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 177345570) has the molecular formula C24H30FN6O6P and a molecular weight of 548.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,2R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,2R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 177345570 |
| Molecular Formula | C24H30FN6O6P |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,2R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | C=C1[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C(F)[C@H](O)[C@H]1COP(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C24H30FN6O6P/c1-12(2)36-23(34)14(4)30-38(37-15-8-6-5-7-9-15)35-10-16-13(3)19(17(25)20(16)32)31-11-27-18-21(31)28-24(26)29-22(18)33/h5-9,11-12,14,16-17,19-20,30,32H,3,10H2,1-2,4H3,(H3,26,28,29,33)/t14-,16-,17?,19+,20+,38?/m0/s1 |
| InChIKey | QGJYXPWYTAXTIF-ATMAAIKHSA-N |
| XLogP | 2.38 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|