C24H28FN2O8P — CID 144900567
[5-[[(E)-2-fluoro-3-oxoprop-1-enyl]-(methylcarbamoyl)amino]oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite (PubChem CID 144900567) has the molecular formula C24H28FN2O8P and a molecular weight of 522.47 g/mol. Its IUPAC name is [5-[[(E)-2-fluoro-3-oxoprop-1-enyl]-(methylcarbamoyl)amino]oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite.
| Compound Name | [5-[[(E)-2-fluoro-3-oxoprop-1-enyl]-(methylcarbamoyl)amino]oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite |
|---|---|
| PubChem CID | 144900567 |
| Molecular Formula | C24H28FN2O8P |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [5-[[(E)-2-fluoro-3-oxoprop-1-enyl]-(methylcarbamoyl)amino]oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite |
| SMILES | CNC(=O)N(/C=C(/F)C=O)C1CCC(COP(Oc2ccc(OC)cc2)Oc2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C24H28FN2O8P/c1-26-24(29)27(14-17(25)15-28)23-13-12-22(33-23)16-32-36(34-20-8-4-18(30-2)5-9-20)35-21-10-6-19(31-3)7-11-21/h4-11,14-15,22-23H,12-13,16H2,1-3H3,(H,26,29)/b17-14+ |
| InChIKey | SNVIRLQOSDVVFQ-SAPNQHFASA-N |
| XLogP | 4.56 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|