C24H25F4N2O8P — CID 144900153
difluoromethane;[3-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite (PubChem CID 144900153) has the molecular formula C24H25F4N2O8P and a molecular weight of 576.44 g/mol. Its IUPAC name is difluoromethane;[3-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite.
| Compound Name | difluoromethane;[3-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite |
|---|---|
| PubChem CID | 144900153 |
| Molecular Formula | C24H25F4N2O8P |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | difluoromethane;[3-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite |
| SMILES | COc1ccc(OP(OCC2OC(n3cc(F)c(=O)[nH]c3=O)CC2F)Oc2ccc(OC)cc2)cc1.FCF |
| InChI | InChI=1S/C23H23F2N2O8P.CH2F2/c1-30-14-3-7-16(8-4-14)34-36(35-17-9-5-15(31-2)6-10-17)32-13-20-18(24)11-21(33-20)27-12-19(25)22(28)26-23(27)29;2-1-3/h3-10,12,18,20-21H,11,13H2,1-2H3,(H,26,28,29);1H2 |
| InChIKey | ZOOWCPQLGJCXLP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|