C24H26ClF2N2O9P — CID 144900568
[5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane (PubChem CID 144900568) has the molecular formula C24H26ClF2N2O9P and a molecular weight of 590.90 g/mol. Its IUPAC name is [5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane.
| Compound Name | [5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane |
|---|---|
| PubChem CID | 144900568 |
| Molecular Formula | C24H26ClF2N2O9P |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | [5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane |
| SMILES | COc1ccc(OP(OCC2CC(O)C(n3cc(Cl)c(=O)[nH]c3=O)O2)Oc2ccc(OC)cc2)cc1.FCF |
| InChI | InChI=1S/C23H24ClN2O9P.CH2F2/c1-30-14-3-7-16(8-4-14)34-36(35-17-9-5-15(31-2)6-10-17)32-13-18-11-20(27)22(33-18)26-12-19(24)21(28)25-23(26)29;2-1-3/h3-10,12,18,20,22,27H,11,13H2,1-2H3,(H,25,28,29);1H2 |
| InChIKey | NPQOBOOCZBZPII-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|