C36H33FN2O6 — CID 10722410
5-fluoro-1-[(2R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10722410) has the molecular formula C36H33FN2O6 and a molecular weight of 608.67 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(2R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10722410 |
| Molecular Formula | C36H33FN2O6 |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 5-fluoro-1-[(2R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(CO[C@H]2C[C@H](n3cc(F)c(=O)[nH]c3=O)O[C@@H]2COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H33FN2O6/c1-42-29-19-17-25(18-20-29)23-43-31-21-33(39-22-30(37)34(40)38-35(39)41)45-32(31)24-44-36(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,22,31-33H,21,23-24H2,1H3,(H,38,40,41)/t31-,32+,33+/m0/s1 |
| InChIKey | QBJHQCZMDYFGJP-WIHCDAFUSA-N |
| XLogP | 5.57 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|