C37H33FN2O5 — CID 54362778
5-fluoro-1-[(2R,4S,5R)-4-(3-phenylprop-2-enoxy)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54362778) has the molecular formula C37H33FN2O5 and a molecular weight of 604.68 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,4S,5R)-4-(3-phenylprop-2-enoxy)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(2R,4S,5R)-4-(3-phenylprop-2-enoxy)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54362778 |
| Molecular Formula | C37H33FN2O5 |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 5-fluoro-1-[(2R,4S,5R)-4-(3-phenylprop-2-enoxy)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](OCC=Cc3ccccc3)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)cc1F |
| InChI | InChI=1S/C37H33FN2O5/c38-31-25-40(36(42)39-35(31)41)34-24-32(43-23-13-16-27-14-5-1-6-15-27)33(45-34)26-44-37(28-17-7-2-8-18-28,29-19-9-3-10-20-29)30-21-11-4-12-22-30/h1-22,25,32-34H,23-24,26H2,(H,39,41,42)/t32-,33+,34+/m0/s1 |
| InChIKey | UNQWHVMXJMMRST-LBFZIJHGSA-N |
| XLogP | 6.07 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|