C36H31F3N2O5 — CID 70420468
1-[(2S,5S)-4-phenylmethoxy-5-(trityloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 70420468) has the molecular formula C36H31F3N2O5 and a molecular weight of 628.65 g/mol. Its IUPAC name is 1-[(2S,5S)-4-phenylmethoxy-5-(trityloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-4-phenylmethoxy-5-(trityloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70420468 |
| Molecular Formula | C36H31F3N2O5 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 1-[(2S,5S)-4-phenylmethoxy-5-(trityloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2CC(OCc3ccccc3)[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C36H31F3N2O5/c37-36(38,39)29-22-41(34(43)40-33(29)42)32-21-30(44-23-25-13-5-1-6-14-25)31(46-32)24-45-35(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,22,30-32H,21,23-24H2,(H,40,42,43)/t30?,31-,32-/m0/s1 |
| InChIKey | PIMNUXXPDVIOLF-ZPQRHCBNSA-N |
| XLogP | 6.44 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|