C17H21F3N2O6 — CID 139643413
1-[(2R,4S,5R)-5-(2-methoxypropan-2-yloxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139643413) has the molecular formula C17H21F3N2O6 and a molecular weight of 406.36 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(2-methoxypropan-2-yloxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-(2-methoxypropan-2-yloxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139643413 |
| Molecular Formula | C17H21F3N2O6 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(2-methoxypropan-2-yloxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(C)(C)OC |
| InChI | InChI=1S/C17H21F3N2O6/c1-5-6-26-11-7-13(28-12(11)9-27-16(2,3)25-4)22-8-10(17(18,19)20)14(23)21-15(22)24/h1,8,11-13H,6-7,9H2,2-4H3,(H,21,23,24)/t11-,12+,13+/m0/s1 |
| InChIKey | APRVGEUSZIZFEG-YNEHKIRRSA-N |
| XLogP | 1.26 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|