C19H25F3N2O6 — CID 139611729
1-[(2R,4S,5R)-4-(4,4-dimethylpent-2-ynoxy)-5-(methoxymethoxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139611729) has the molecular formula C19H25F3N2O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-(4,4-dimethylpent-2-ynoxy)-5-(methoxymethoxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-(4,4-dimethylpent-2-ynoxy)-5-(methoxymethoxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139611729 |
| Molecular Formula | C19H25F3N2O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-[(2R,4S,5R)-4-(4,4-dimethylpent-2-ynoxy)-5-(methoxymethoxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | COCOC[C@H]1O[C@@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)C[C@@H]1OCC#CC(C)(C)C |
| InChI | InChI=1S/C19H25F3N2O6/c1-18(2,3)6-5-7-29-13-8-15(30-14(13)10-28-11-27-4)24-9-12(19(20,21)22)16(25)23-17(24)26/h9,13-15H,7-8,10-11H2,1-4H3,(H,23,25,26)/t13-,14+,15+/m0/s1 |
| InChIKey | RGEOSSTYGNVGML-RRFJBIMHSA-N |
| XLogP | 1.90 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|