C24H33F3N2O7 — CID 139611593
decyl [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl carbonate (PubChem CID 139611593) has the molecular formula C24H33F3N2O7 and a molecular weight of 518.53 g/mol. Its IUPAC name is decyl [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl carbonate.
| Compound Name | decyl [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 139611593 |
| Molecular Formula | C24H33F3N2O7 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | decyl [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl carbonate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C24H33F3N2O7/c1-3-5-6-7-8-9-10-11-13-34-23(32)35-16-19-18(33-12-4-2)14-20(36-19)29-15-17(24(25,26)27)21(30)28-22(29)31/h2,15,18-20H,3,5-14,16H2,1H3,(H,28,30,31)/t18-,19+,20+/m0/s1 |
| InChIKey | MMTPFEAEPOFXOR-XUVXKRRUSA-N |
| XLogP | 4.16 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|