C25H39F3N2O5Si — CID 139611651
1-[(2R,4S,5R)-4-prop-2-ynoxy-5-(tributylsilyloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139611651) has the molecular formula C25H39F3N2O5Si and a molecular weight of 532.68 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-prop-2-ynoxy-5-(tributylsilyloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-prop-2-ynoxy-5-(tributylsilyloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139611651 |
| Molecular Formula | C25H39F3N2O5Si |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 1-[(2R,4S,5R)-4-prop-2-ynoxy-5-(tributylsilyloxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1CO[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C25H39F3N2O5Si/c1-5-9-13-36(14-10-6-2,15-11-7-3)34-18-21-20(33-12-8-4)16-22(35-21)30-17-19(25(26,27)28)23(31)29-24(30)32/h4,17,20-22H,5-7,9-16,18H2,1-3H3,(H,29,31,32)/t20-,21+,22+/m0/s1 |
| InChIKey | VCTJTVPHKRTJNO-BHDDXSALSA-N |
| XLogP | 5.22 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|