C22H21F3N2O5S — CID 139653725
O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 4-ethylbenzenecarbothioate (PubChem CID 139653725) has the molecular formula C22H21F3N2O5S and a molecular weight of 482.48 g/mol. Its IUPAC name is O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 4-ethylbenzenecarbothioate.
| Compound Name | O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 4-ethylbenzenecarbothioate |
|---|---|
| PubChem CID | 139653725 |
| Molecular Formula | C22H21F3N2O5S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 4-ethylbenzenecarbothioate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=S)c1ccc(CC)cc1 |
| InChI | InChI=1S/C22H21F3N2O5S/c1-3-9-30-16-10-18(27-11-15(22(23,24)25)19(28)26-21(27)29)32-17(16)12-31-20(33)14-7-5-13(4-2)6-8-14/h1,5-8,11,16-18H,4,9-10,12H2,2H3,(H,26,28,29)/t16-,17+,18+/m0/s1 |
| InChIKey | CXLPOXDAFUOAPX-RCCFBDPRSA-N |
| XLogP | 2.82 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|