C23H23F3N2O6S — CID 139653743
O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2-propoxybenzenecarbothioate (PubChem CID 139653743) has the molecular formula C23H23F3N2O6S and a molecular weight of 512.51 g/mol. Its IUPAC name is O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2-propoxybenzenecarbothioate.
| Compound Name | O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2-propoxybenzenecarbothioate |
|---|---|
| PubChem CID | 139653743 |
| Molecular Formula | C23H23F3N2O6S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2-propoxybenzenecarbothioate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=S)c1ccccc1OCCC |
| InChI | InChI=1S/C23H23F3N2O6S/c1-3-9-31-16-8-6-5-7-14(16)21(35)33-13-18-17(32-10-4-2)11-19(34-18)28-12-15(23(24,25)26)20(29)27-22(28)30/h2,5-8,12,17-19H,3,9-11,13H2,1H3,(H,27,29,30)/t17-,18+,19+/m0/s1 |
| InChIKey | DZDXXERMZKLDHU-IPMKNSEASA-N |
| XLogP | 3.04 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|