C21H27F3N2O6 — CID 139611605
[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octanoate (PubChem CID 139611605) has the molecular formula C21H27F3N2O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octanoate.
| Compound Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 139611605 |
| Molecular Formula | C21H27F3N2O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octanoate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=O)CCCCCCC |
| InChI | InChI=1S/C21H27F3N2O6/c1-3-5-6-7-8-9-18(27)31-13-16-15(30-10-4-2)11-17(32-16)26-12-14(21(22,23)24)19(28)25-20(26)29/h2,12,15-17H,3,5-11,13H2,1H3,(H,25,28,29)/t15-,16+,17+/m0/s1 |
| InChIKey | IILFQAAHPVTPBJ-GVDBMIGSSA-N |
| XLogP | 2.77 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|