C22H29F3N2O7 — CID 139611536
[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octyl carbonate (PubChem CID 139611536) has the molecular formula C22H29F3N2O7 and a molecular weight of 490.48 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octyl carbonate.
| Compound Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octyl carbonate |
|---|---|
| PubChem CID | 139611536 |
| Molecular Formula | C22H29F3N2O7 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl octyl carbonate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=O)OCCCCCCCC |
| InChI | InChI=1S/C22H29F3N2O7/c1-3-5-6-7-8-9-11-32-21(30)33-14-17-16(31-10-4-2)12-18(34-17)27-13-15(22(23,24)25)19(28)26-20(27)29/h2,13,16-18H,3,5-12,14H2,1H3,(H,26,28,29)/t16-,17+,18+/m0/s1 |
| InChIKey | WEOPESWCTWYGBL-RCCFBDPRSA-N |
| XLogP | 3.38 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|