C20H25F3N2O6S — CID 139653847
[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl hexylsulfanylformate (PubChem CID 139653847) has the molecular formula C20H25F3N2O6S and a molecular weight of 478.49 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl hexylsulfanylformate.
| Compound Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl hexylsulfanylformate |
|---|---|
| PubChem CID | 139653847 |
| Molecular Formula | C20H25F3N2O6S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl hexylsulfanylformate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=O)SCCCCCC |
| InChI | InChI=1S/C20H25F3N2O6S/c1-3-5-6-7-9-32-19(28)30-12-15-14(29-8-4-2)10-16(31-15)25-11-13(20(21,22)23)17(26)24-18(25)27/h2,11,14-16H,3,5-10,12H2,1H3,(H,24,26,27)/t14-,15+,16+/m0/s1 |
| InChIKey | LNDGLZIGTFVJNX-ARFHVFGLSA-N |
| XLogP | 3.31 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|