C15H15F3N2O6S — CID 139653759
[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl methylsulfanylformate (PubChem CID 139653759) has the molecular formula C15H15F3N2O6S and a molecular weight of 408.35 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl methylsulfanylformate.
| Compound Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl methylsulfanylformate |
|---|---|
| PubChem CID | 139653759 |
| Molecular Formula | C15H15F3N2O6S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl methylsulfanylformate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=O)SC |
| InChI | InChI=1S/C15H15F3N2O6S/c1-3-4-24-9-5-11(26-10(9)7-25-14(23)27-2)20-6-8(15(16,17)18)12(21)19-13(20)22/h1,6,9-11H,4-5,7H2,2H3,(H,19,21,22)/t9-,10+,11+/m0/s1 |
| InChIKey | QJTKVTAWGAYLAW-HBNTYKKESA-N |
| XLogP | 1.36 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|