C20H15Cl2F3N2O5S — CID 139653787
O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2,3-dichlorobenzenecarbothioate (PubChem CID 139653787) has the molecular formula C20H15Cl2F3N2O5S and a molecular weight of 523.32 g/mol. Its IUPAC name is O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2,3-dichlorobenzenecarbothioate.
| Compound Name | O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2,3-dichlorobenzenecarbothioate |
|---|---|
| PubChem CID | 139653787 |
| Molecular Formula | C20H15Cl2F3N2O5S |
| Molecular Weight | 523.32 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | O-[[(2R,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-prop-2-ynoxyoxolan-2-yl]methyl] 2,3-dichlorobenzenecarbothioate |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1COC(=S)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H15Cl2F3N2O5S/c1-2-6-30-13-7-15(27-8-11(20(23,24)25)17(28)26-19(27)29)32-14(13)9-31-18(33)10-4-3-5-12(21)16(10)22/h1,3-5,8,13-15H,6-7,9H2,(H,26,28,29)/t13-,14+,15+/m0/s1 |
| InChIKey | DCJQDPKWKRFZQE-RRFJBIMHSA-N |
| XLogP | 3.56 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|