C24H26F4N3O7P — CID 144900440
[5-(4-amino-2-oxopyrimidin-1-yl)-3,3-difluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane (PubChem CID 144900440) has the molecular formula C24H26F4N3O7P and a molecular weight of 575.45 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-3,3-difluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-3,3-difluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane |
|---|---|
| PubChem CID | 144900440 |
| Molecular Formula | C24H26F4N3O7P |
| Molecular Weight | 575.45 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-3,3-difluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite;difluoromethane |
| SMILES | COc1ccc(OP(OCC2OC(n3ccc(N)nc3=O)CC2(F)F)Oc2ccc(OC)cc2)cc1.FCF |
| InChI | InChI=1S/C23H24F2N3O7P.CH2F2/c1-30-15-3-7-17(8-4-15)34-36(35-18-9-5-16(31-2)6-10-18)32-14-19-23(24,25)13-21(33-19)28-12-11-20(26)27-22(28)29;2-1-3/h3-12,19,21H,13-14H2,1-2H3,(H2,26,27,29);1H2 |
| InChIKey | SGWXENFXPMNGPP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|