C16H16F2N3O5P — CID 144900619
4-amino-1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-4,4-difluorooxolan-2-yl]pyrimidin-2-one (PubChem CID 144900619) has the molecular formula C16H16F2N3O5P and a molecular weight of 399.29 g/mol. Its IUPAC name is 4-amino-1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-4,4-difluorooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-4,4-difluorooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 144900619 |
| Molecular Formula | C16H16F2N3O5P |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-amino-1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-4,4-difluorooxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2CC(F)(F)C(COP3OCc4ccccc4O3)O2)c(=O)n1 |
| InChI | InChI=1S/C16H16F2N3O5P/c17-16(18)7-14(21-6-5-13(19)20-15(21)22)25-12(16)9-24-27-23-8-10-3-1-2-4-11(10)26-27/h1-6,12,14H,7-9H2,(H2,19,20,22) |
| InChIKey | JQQJECDBXGBWBZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|