C33H38N2O6 — CID 178082474
1-[(5S)-5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea (PubChem CID 178082474) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is 1-[(5S)-5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea.
| Compound Name | 1-[(5S)-5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
|---|---|
| PubChem CID | 178082474 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 1-[(5S)-5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
| SMILES | CNC(=O)N(/C=C\C=O)C1CC[C@@H](CC(C)OC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C33H38N2O6/c1-24(23-30-19-20-31(40-30)35(21-8-22-36)32(37)34-2)41-33(25-9-6-5-7-10-25,26-11-15-28(38-3)16-12-26)27-13-17-29(39-4)18-14-27/h5-18,21-22,24,30-31H,19-20,23H2,1-4H3,(H,34,37)/b21-8-/t24?,30-,31?/m0/s1 |
| InChIKey | KUXZYYKDQWIBMA-IEBKRHCHSA-N |
| XLogP | 5.65 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|