C24H31NO3 — CID 171394262
propan-2-yl (2S)-3-cyclopentyl-2-(4-methoxyanilino)-2-phenylpropanoate (PubChem CID 171394262) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is propan-2-yl (2S)-3-cyclopentyl-2-(4-methoxyanilino)-2-phenylpropanoate.
| Compound Name | propan-2-yl (2S)-3-cyclopentyl-2-(4-methoxyanilino)-2-phenylpropanoate |
|---|---|
| PubChem CID | 171394262 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | propan-2-yl (2S)-3-cyclopentyl-2-(4-methoxyanilino)-2-phenylpropanoate |
| SMILES | COc1ccc(N[C@](CC2CCCC2)(C(=O)OC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-18(2)28-23(26)24(17-19-9-7-8-10-19,20-11-5-4-6-12-20)25-21-13-15-22(27-3)16-14-21/h4-6,11-16,18-19,25H,7-10,17H2,1-3H3/t24-/m0/s1 |
| InChIKey | CYTGZIUNPRDMKI-DEOSSOPVSA-N |
| XLogP | 5.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|