C37H46BNO5 — CID 138973240
benzyl (2S,3S)-3-cyclohexyl-2-(4-methoxyanilino)-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate (PubChem CID 138973240) has the molecular formula C37H46BNO5 and a molecular weight of 595.59 g/mol. Its IUPAC name is benzyl (2S,3S)-3-cyclohexyl-2-(4-methoxyanilino)-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate.
| Compound Name | benzyl (2S,3S)-3-cyclohexyl-2-(4-methoxyanilino)-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate |
|---|---|
| PubChem CID | 138973240 |
| Molecular Formula | C37H46BNO5 |
| Molecular Weight | 595.59 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | benzyl (2S,3S)-3-cyclohexyl-2-(4-methoxyanilino)-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@H](C1CCCCC1)[C@@](Nc1ccc(OC)cc1)(C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H46BNO5/c1-27(38-43-35(2,3)36(4,5)44-38)33(29-18-12-8-13-19-29)37(30-20-14-9-15-21-30,39-31-22-24-32(41-6)25-23-31)34(40)42-26-28-16-10-7-11-17-28/h7,9-11,14-17,20-25,29,33,39H,1,8,12-13,18-19,26H2,2-6H3/t33-,37-/m1/s1 |
| InChIKey | HJPADZYYOVSIAR-PZSMLTKBSA-N |
| XLogP | 8.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.59 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|