C21H31NO2 — CID 134950990
(2S)-1,2-dicyclohexyl-2-(4-methoxyanilino)ethanone (PubChem CID 134950990) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is (2S)-1,2-dicyclohexyl-2-(4-methoxyanilino)ethanone.
| Compound Name | (2S)-1,2-dicyclohexyl-2-(4-methoxyanilino)ethanone |
|---|---|
| PubChem CID | 134950990 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (2S)-1,2-dicyclohexyl-2-(4-methoxyanilino)ethanone |
| SMILES | COc1ccc(N[C@H](C(=O)C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H31NO2/c1-24-19-14-12-18(13-15-19)22-20(16-8-4-2-5-9-16)21(23)17-10-6-3-7-11-17/h12-17,20,22H,2-11H2,1H3/t20-/m0/s1 |
| InChIKey | KPQBFTGDMZEMBY-FQEVSTJZSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|