C20H29NO3 — CID 135055916
ethyl (E,5S)-5-cyclohexyl-5-(4-methoxyanilino)pent-2-enoate (PubChem CID 135055916) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is ethyl (E,5S)-5-cyclohexyl-5-(4-methoxyanilino)pent-2-enoate.
| Compound Name | ethyl (E,5S)-5-cyclohexyl-5-(4-methoxyanilino)pent-2-enoate |
|---|---|
| PubChem CID | 135055916 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | ethyl (E,5S)-5-cyclohexyl-5-(4-methoxyanilino)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](Nc1ccc(OC)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H29NO3/c1-3-24-20(22)11-7-10-19(16-8-5-4-6-9-16)21-17-12-14-18(23-2)15-13-17/h7,11-16,19,21H,3-6,8-10H2,1-2H3/b11-7+/t19-/m0/s1 |
| InChIKey | ORNLEZRTQRGYCX-SSVWKNEZSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|