C15H21NO3S — CID 107133000
ethyl 2-(4-methoxyanilino)-2-(thiolan-3-yl)acetate (PubChem CID 107133000) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl 2-(4-methoxyanilino)-2-(thiolan-3-yl)acetate.
| Compound Name | ethyl 2-(4-methoxyanilino)-2-(thiolan-3-yl)acetate |
|---|---|
| PubChem CID | 107133000 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl 2-(4-methoxyanilino)-2-(thiolan-3-yl)acetate |
| SMILES | CCOC(=O)C(Nc1ccc(OC)cc1)C1CCSC1 |
| InChI | InChI=1S/C15H21NO3S/c1-3-19-15(17)14(11-8-9-20-10-11)16-12-4-6-13(18-2)7-5-12/h4-7,11,14,16H,3,8-10H2,1-2H3 |
| InChIKey | FEMZBKZCCXQYFD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|