C17H23NO6 — CID 102320364
ethyl (2S)-2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-(4-methoxyanilino)acetate (PubChem CID 102320364) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is ethyl (2S)-2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-(4-methoxyanilino)acetate.
| Compound Name | ethyl (2S)-2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-(4-methoxyanilino)acetate |
|---|---|
| PubChem CID | 102320364 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | ethyl (2S)-2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-(4-methoxyanilino)acetate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(OC)cc1)[C@H]1OC(C)(C)OCC1=O |
| InChI | InChI=1S/C17H23NO6/c1-5-22-16(20)14(15-13(19)10-23-17(2,3)24-15)18-11-6-8-12(21-4)9-7-11/h6-9,14-15,18H,5,10H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | FMQXYQOCEDXUIA-GJZGRUSLSA-N |
| XLogP | 1.76 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|