C20H31NO7 — CID 100975107
ethyl (3S)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-3-(4-methoxyanilino)propanoate (PubChem CID 100975107) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is ethyl (3S)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-3-(4-methoxyanilino)propanoate.
| Compound Name | ethyl (3S)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-3-(4-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 100975107 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | ethyl (3S)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-3-(4-methoxyanilino)propanoate |
| SMILES | CCOC(=O)C[C@H](Nc1ccc(OC)cc1)C1(C)O[C@@H](COC)[C@H](COC)O1 |
| InChI | InChI=1S/C20H31NO7/c1-6-26-19(22)11-18(21-14-7-9-15(25-5)10-8-14)20(2)27-16(12-23-3)17(28-20)13-24-4/h7-10,16-18,21H,6,11-13H2,1-5H3/t16-,17-,18-/m0/s1 |
| InChIKey | RQFGRPXPYMLNRP-BZSNNMDCSA-N |
| XLogP | 2.22 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|