C20H29NO4 — CID 102320362
ethyl (2S)-2-(4-methoxyanilino)-2-[(1R,5S)-2-oxo-5-propan-2-ylcyclohexyl]acetate (PubChem CID 102320362) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is ethyl (2S)-2-(4-methoxyanilino)-2-[(1R,5S)-2-oxo-5-propan-2-ylcyclohexyl]acetate.
| Compound Name | ethyl (2S)-2-(4-methoxyanilino)-2-[(1R,5S)-2-oxo-5-propan-2-ylcyclohexyl]acetate |
|---|---|
| PubChem CID | 102320362 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | ethyl (2S)-2-(4-methoxyanilino)-2-[(1R,5S)-2-oxo-5-propan-2-ylcyclohexyl]acetate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(OC)cc1)[C@H]1C[C@@H](C(C)C)CCC1=O |
| InChI | InChI=1S/C20H29NO4/c1-5-25-20(23)19(21-15-7-9-16(24-4)10-8-15)17-12-14(13(2)3)6-11-18(17)22/h7-10,13-14,17,19,21H,5-6,11-12H2,1-4H3/t14-,17-,19-/m0/s1 |
| InChIKey | SJXALPZTRHKHHB-FNHZYXHNSA-N |
| XLogP | 3.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|