C18H26N2O6 — CID 139248859
methyl 3-[[(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methoxyanilino)acetyl]amino]propanoate (PubChem CID 139248859) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methoxyanilino)acetyl]amino]propanoate.
| Compound Name | methyl 3-[[(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methoxyanilino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 139248859 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | methyl 3-[[(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methoxyanilino)acetyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H](Nc1ccc(OC)cc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H26N2O6/c1-18(2)25-11-14(26-18)16(17(22)19-10-9-15(21)24-4)20-12-5-7-13(23-3)8-6-12/h5-8,14,16,20H,9-11H2,1-4H3,(H,19,22)/t14-,16+/m1/s1 |
| InChIKey | IOZNPWDFUBJRQW-ZBFHGGJFSA-N |
| XLogP | 1.31 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|