C20H30O2 — CID 23516255
2-phenylpropan-2-yl 2-cyclohexyl-3-methylbutanoate (PubChem CID 23516255) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-cyclohexyl-3-methylbutanoate.
| Compound Name | 2-phenylpropan-2-yl 2-cyclohexyl-3-methylbutanoate |
|---|---|
| PubChem CID | 23516255 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-phenylpropan-2-yl 2-cyclohexyl-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OC(C)(C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30O2/c1-15(2)18(16-11-7-5-8-12-16)19(21)22-20(3,4)17-13-9-6-10-14-17/h6,9-10,13-16,18H,5,7-8,11-12H2,1-4H3 |
| InChIKey | HFYBOZCHLUDCRC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |