C27H38N2O4 — CID 74934592
cyclohexanamine;3-methyl-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]butanoic acid (PubChem CID 74934592) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is cyclohexanamine;3-methyl-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]butanoic acid.
| Compound Name | cyclohexanamine;3-methyl-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 74934592 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | cyclohexanamine;3-methyl-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]butanoic acid |
| SMILES | CC(C)C(NC(=O)OC(C)(C)c1ccc(-c2ccccc2)cc1)C(=O)O.NC1CCCCC1 |
| InChI | InChI=1S/C21H25NO4.C6H13N/c1-14(2)18(19(23)24)22-20(25)26-21(3,4)17-12-10-16(11-13-17)15-8-6-5-7-9-15;7-6-4-2-1-3-5-6/h5-14,18H,1-4H3,(H,22,25)(H,23,24);6H,1-5,7H2 |
| InChIKey | QKSNECXABWULCS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |