C28H38N2O4S — CID 145374744
2-(4-phenylphenyl)propan-2-yl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]-(2-sulfanylpropan-2-yl)amino]pentan-2-yl]carbamate (PubChem CID 145374744) has the molecular formula C28H38N2O4S and a molecular weight of 498.69 g/mol. Its IUPAC name is 2-(4-phenylphenyl)propan-2-yl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]-(2-sulfanylpropan-2-yl)amino]pentan-2-yl]carbamate.
| Compound Name | 2-(4-phenylphenyl)propan-2-yl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]-(2-sulfanylpropan-2-yl)amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 145374744 |
| Molecular Formula | C28H38N2O4S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-(4-phenylphenyl)propan-2-yl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]-(2-sulfanylpropan-2-yl)amino]pentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)c1ccc(-c2ccccc2)cc1)C(=O)N([C@@H](C)C=O)C(C)(C)S |
| InChI | InChI=1S/C28H38N2O4S/c1-19(2)17-24(25(32)30(20(3)18-31)28(6,7)35)29-26(33)34-27(4,5)23-15-13-22(14-16-23)21-11-9-8-10-12-21/h8-16,18-20,24,35H,17H2,1-7H3,(H,29,33)/t20-,24-/m0/s1 |
| InChIKey | NYXPWZQGJUGERW-RDPSFJRHSA-N |
| XLogP | 5.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|