C22H35N3O5 — CID 132581418
methyl (2R)-2-amino-2-[benzyl-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate (PubChem CID 132581418) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-[benzyl-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate.
| Compound Name | methyl (2R)-2-amino-2-[benzyl-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 132581418 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | methyl (2R)-2-amino-2-[benzyl-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate |
| SMILES | COC(=O)[C@](C)(N)N(Cc1ccccc1)C(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O5/c1-15(2)13-17(24-20(28)30-21(3,4)5)18(26)25(22(6,23)19(27)29-7)14-16-11-9-8-10-12-16/h8-12,15,17H,13-14,23H2,1-7H3,(H,24,28)/t17-,22+/m0/s1 |
| InChIKey | GWJREXXWQRNDAF-HTAPYJJXSA-N |
| XLogP | 2.80 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|