C14H16F3NO4 — CID 165413281
3-methyl-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]butanoic acid (PubChem CID 165413281) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 3-methyl-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 165413281 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-methyl-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]butanoic acid |
| SMILES | CC(C)C(NC(=O)OCc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H16F3NO4/c1-8(2)11(12(19)20)18-13(21)22-7-9-3-5-10(6-4-9)14(15,16)17/h3-6,8,11H,7H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | ZAQYCQLGBRKVFA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |