C26H33NO5 — CID 171394249
propan-2-yl (2S)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-(4-methoxyanilino)-2-phenylacetate (PubChem CID 171394249) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is propan-2-yl (2S)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-(4-methoxyanilino)-2-phenylacetate.
| Compound Name | propan-2-yl (2S)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-(4-methoxyanilino)-2-phenylacetate |
|---|---|
| PubChem CID | 171394249 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | propan-2-yl (2S)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-(4-methoxyanilino)-2-phenylacetate |
| SMILES | COc1ccc(N[C@](C(=O)OC(C)C)(c2ccccc2)C2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C26H33NO5/c1-19(2)32-24(28)26(20-7-5-4-6-8-20,27-22-9-11-23(29-3)12-10-22)21-13-15-25(16-14-21)30-17-18-31-25/h4-12,19,21,27H,13-18H2,1-3H3/t26-/m1/s1 |
| InChIKey | UKUFBOKLCJQXTQ-AREMUKBSSA-N |
| XLogP | 4.89 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|