C25H27BO4 — CID 177315687
CID 177315687 (PubChem CID 177315687) has the molecular formula C25H27BO4 and a molecular weight of 402.30 g/mol.
| Compound Name | CID 177315687 |
|---|---|
| PubChem CID | 177315687 |
| Molecular Formula | C25H27BO4 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | — |
| SMILES | [B]CC(O)C(C)OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H27BO4/c1-18(24(27)17-26)30-25(19-7-5-4-6-8-19,20-9-13-22(28-2)14-10-20)21-11-15-23(29-3)16-12-21/h4-16,18,24,27H,17H2,1-3H3 |
| InChIKey | UMBBHZKWXZGTJO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|