C8H12O6 — CID 170549993
2-ethyl-2-methyl-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 170549993) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-ethyl-2-methyl-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | 2-ethyl-2-methyl-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 170549993 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-ethyl-2-methyl-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | CCC1(C)OC(C(=O)O)C(C(=O)O)O1 |
| InChI | InChI=1S/C8H12O6/c1-3-8(2)13-4(6(9)10)5(14-8)7(11)12/h4-5H,3H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | RPGGSFYWLSHNQN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |