C11H17BrO6 — CID 10782268
diethyl (4R,5R)-2-(bromomethyl)-2-methyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 10782268) has the molecular formula C11H17BrO6 and a molecular weight of 325.16 g/mol. Its IUPAC name is diethyl (4R,5R)-2-(bromomethyl)-2-methyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-(bromomethyl)-2-methyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10782268 |
| Molecular Formula | C11H17BrO6 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | diethyl (4R,5R)-2-(bromomethyl)-2-methyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1OC(C)(CBr)O[C@H]1C(=O)OCC |
| InChI | InChI=1S/C11H17BrO6/c1-4-15-9(13)7-8(10(14)16-5-2)18-11(3,6-12)17-7/h7-8H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | KNLQAAVSQSQKAX-HTQZYQBOSA-N |
| XLogP | 1.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|