2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid

C8H13NO5 — CID 59983974

IUPAC2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid
SMILESCNC(=O)C1OC(C)(C)OC1C(=O)O
InChIInChI=1S/C8H13NO5/c1-8(2)13-4(6(10)9-3)5(14-8)7(11)12/h4-5H,1-3H3,(H,9,10)(H,11,12)
InChIKeyMUMYXWMCWYWCPC-UHFFFAOYSA-N
MW203.19 g/mol
LogP-0.66
Rot. Bonds2

About 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid

2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 59983974) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid.

Molecular Properties

Compound Name2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid
PubChem CID59983974
Molecular FormulaC8H13NO5
Molecular Weight203.19 g/mol
Exact Mass203.08
IUPAC Name2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid
SMILESCNC(=O)C1OC(C)(C)OC1C(=O)O
InChIInChI=1S/C8H13NO5/c1-8(2)13-4(6(10)9-3)5(14-8)7(11)12/h4-5H,1-3H3,(H,9,10)(H,11,12)
InChIKeyMUMYXWMCWYWCPC-UHFFFAOYSA-N
XLogP-0.66
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.19
LogP ≤ 5-0.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid (CID 59983974) is 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid is CNC(=O)C1OC(C)(C)OC1C(=O)O.
What is the InChIKey of 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid?
The InChIKey is MUMYXWMCWYWCPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-8(2)13-4(6(10)9-3)5(14-8)7(11)12/h4-5H,1-3H3,(H,9,10)(H,11,12).
What are the key properties of 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid?
2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid has a molecular weight of 203.19 g/mol, XLogP of -0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-(methylcarbamoyl)-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 59983974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).