C7H11IO4 — CID 11601660
(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 11601660) has the molecular formula C7H11IO4 and a molecular weight of 286.07 g/mol. Its IUPAC name is (4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 11601660 |
| Molecular Formula | C7H11IO4 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | (4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@H](C(=O)O)[C@@H](CI)O1 |
| InChI | InChI=1S/C7H11IO4/c1-7(2)11-4(3-8)5(12-7)6(9)10/h4-5H,3H2,1-2H3,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | HQPJKOMUZLPOFM-UHNVWZDZSA-N |
| XLogP | 1.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|