C20H23IO5 — CID 11784677
1-[(4R,5S)-5-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylprop-2-yn-1-one (PubChem CID 11784677) has the molecular formula C20H23IO5 and a molecular weight of 470.30 g/mol. Its IUPAC name is 1-[(4R,5S)-5-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylprop-2-yn-1-one.
| Compound Name | 1-[(4R,5S)-5-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylprop-2-yn-1-one |
|---|---|
| PubChem CID | 11784677 |
| Molecular Formula | C20H23IO5 |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-[(4R,5S)-5-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylprop-2-yn-1-one |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC(C)(C)O[C@H]2C(=O)C#Cc2ccccc2)[C@@H](CI)O1 |
| InChI | InChI=1S/C20H23IO5/c1-19(2)23-15(12-21)17(25-19)18-16(24-20(3,4)26-18)14(22)11-10-13-8-6-5-7-9-13/h5-9,15-18H,12H2,1-4H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | TXFFDOSALSZFQG-XMTFNYHQSA-N |
| XLogP | 3.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|