C14H15NO6 — CID 25018901
(4R,5R)-5-(benzoylcarbamoyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 25018901) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is (4R,5R)-5-(benzoylcarbamoyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5R)-5-(benzoylcarbamoyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 25018901 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (4R,5R)-5-(benzoylcarbamoyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H](C(=O)O)[C@H](C(=O)NC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H15NO6/c1-14(2)20-9(10(21-14)13(18)19)12(17)15-11(16)8-6-4-3-5-7-8/h3-7,9-10H,1-2H3,(H,18,19)(H,15,16,17)/t9-,10-/m1/s1 |
| InChIKey | FRBJAHPBTXFKGD-NXEZZACHSA-N |
| XLogP | 0.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|