C15H17NO3 — CID 10858189
N-[(3aR,4S,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]benzamide (PubChem CID 10858189) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is N-[(3aR,4S,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]benzamide.
| Compound Name | N-[(3aR,4S,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]benzamide |
|---|---|
| PubChem CID | 10858189 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[(3aR,4S,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]benzamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](NC(=O)c3ccccc3)C=C[C@@H]2O1 |
| InChI | InChI=1S/C15H17NO3/c1-15(2)18-12-9-8-11(13(12)19-15)16-14(17)10-6-4-3-5-7-10/h3-9,11-13H,1-2H3,(H,16,17)/t11-,12-,13+/m0/s1 |
| InChIKey | WTOLFCKYBJJFIB-RWMBFGLXSA-N |
| XLogP | 1.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|