C17H21NO5 — CID 570044
(4-benzamido-5,6-dimethoxycyclohex-2-en-1-yl) acetate (PubChem CID 570044) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (4-benzamido-5,6-dimethoxycyclohex-2-en-1-yl) acetate.
| Compound Name | (4-benzamido-5,6-dimethoxycyclohex-2-en-1-yl) acetate |
|---|---|
| PubChem CID | 570044 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4-benzamido-5,6-dimethoxycyclohex-2-en-1-yl) acetate |
| SMILES | COC1C(NC(=O)c2ccccc2)C=CC(OC(C)=O)C1OC |
| InChI | InChI=1S/C17H21NO5/c1-11(19)23-14-10-9-13(15(21-2)16(14)22-3)18-17(20)12-7-5-4-6-8-12/h4-10,13-16H,1-3H3,(H,18,20) |
| InChIKey | GZOSJHTZCSGOOT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|