C27H31NO6 — CID 5471650
N-[(Z)-3-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-4-phenylbut-2-en-2-yl]benzamide (PubChem CID 5471650) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[(Z)-3-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-4-phenylbut-2-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-4-phenylbut-2-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5471650 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[(Z)-3-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-4-phenylbut-2-en-2-yl]benzamide |
| SMILES | C/C(NC(=O)c1ccccc1)=C(/C(=O)c1ccccc1)[C@@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H31NO6/c1-17(28-25(30)19-14-10-7-11-15-19)21(22(29)18-12-8-6-9-13-18)24-23(33-27(4,5)34-24)20-16-31-26(2,3)32-20/h6-15,20,23-24H,16H2,1-5H3,(H,28,30)/b21-17+/t20-,23-,24+/m1/s1 |
| InChIKey | RNQHJAUDECDLLW-DDVBNKGPSA-N |
| XLogP | 4.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|