C20H28O6 — CID 101060939
(3R)-1-[(4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-phenylbutan-1-one (PubChem CID 101060939) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3R)-1-[(4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-phenylbutan-1-one.
| Compound Name | (3R)-1-[(4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 101060939 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3R)-1-[(4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-phenylbutan-1-one |
| SMILES | CC1(C)OC[C@@H]([C@@H]2OC(C)(C)O[C@H]2C(=O)C[C@@](C)(O)c2ccccc2)O1 |
| InChI | InChI=1S/C20H28O6/c1-18(2)23-12-15(24-18)17-16(25-19(3,4)26-17)14(21)11-20(5,22)13-9-7-6-8-10-13/h6-10,15-17,22H,11-12H2,1-5H3/t15-,16-,17-,20+/m0/s1 |
| InChIKey | OHAOJLQAUXRRHT-OGNFBWPZSA-N |
| XLogP | 2.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |